C15H22N2O3S2 — CID 25044457
3-cyclohexylsulfanyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 25044457) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-cyclohexylsulfanyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 25044457 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-cyclohexylsulfanyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCSC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H22N2O3S2/c16-22(19,20)14-8-6-12(7-9-14)17-15(18)10-11-21-13-4-2-1-3-5-13/h6-9,13H,1-5,10-11H2,(H,17,18)(H2,16,19,20) |
| InChIKey | HMSDRBBFBFHTHX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |