C13H14O5S — CID 82165154
methyl 2-[4-(cyclopropanecarbonyl)phenyl]sulfonylacetate (PubChem CID 82165154) has the molecular formula C13H14O5S and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 2-[4-(cyclopropanecarbonyl)phenyl]sulfonylacetate.
| Compound Name | methyl 2-[4-(cyclopropanecarbonyl)phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 82165154 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | methyl 2-[4-(cyclopropanecarbonyl)phenyl]sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)c1ccc(C(=O)C2CC2)cc1 |
| InChI | InChI=1S/C13H14O5S/c1-18-12(14)8-19(16,17)11-6-4-10(5-7-11)13(15)9-2-3-9/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | XFQDAUKCDNUQBF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |