C18H17NO5S — CID 110424063
methyl 2-[[4-(cyclopropanecarbonyl)phenyl]sulfonylamino]benzoate (PubChem CID 110424063) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is methyl 2-[[4-(cyclopropanecarbonyl)phenyl]sulfonylamino]benzoate.
| Compound Name | methyl 2-[[4-(cyclopropanecarbonyl)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 110424063 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | methyl 2-[[4-(cyclopropanecarbonyl)phenyl]sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)c1ccc(C(=O)C2CC2)cc1 |
| InChI | InChI=1S/C18H17NO5S/c1-24-18(21)15-4-2-3-5-16(15)19-25(22,23)14-10-8-13(9-11-14)17(20)12-6-7-12/h2-5,8-12,19H,6-7H2,1H3 |
| InChIKey | RZQWJVPFIDCDDJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |