C18H27N3O4S — CID 108958583
N-cyclopentyl-2,2-dimethyl-N'-[2-(4-sulfamoylphenyl)ethyl]propanediamide (PubChem CID 108958583) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-cyclopentyl-2,2-dimethyl-N'-[2-(4-sulfamoylphenyl)ethyl]propanediamide.
| Compound Name | N-cyclopentyl-2,2-dimethyl-N'-[2-(4-sulfamoylphenyl)ethyl]propanediamide |
|---|---|
| PubChem CID | 108958583 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-cyclopentyl-2,2-dimethyl-N'-[2-(4-sulfamoylphenyl)ethyl]propanediamide |
| SMILES | CC(C)(C(=O)NCCc1ccc(S(N)(=O)=O)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H27N3O4S/c1-18(2,17(23)21-14-5-3-4-6-14)16(22)20-12-11-13-7-9-15(10-8-13)26(19,24)25/h7-10,14H,3-6,11-12H2,1-2H3,(H,20,22)(H,21,23)(H2,19,24,25) |
| InChIKey | CXUVGSNAZSUFPM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|