C18H27ClN2O3S — CID 108759314
3-chloro-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-2,2-dimethylpropanamide (PubChem CID 108759314) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is 3-chloro-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 108759314 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-chloro-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NCCc1ccc(S(=O)(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C18H27ClN2O3S/c1-18(2,13-19)17(22)20-12-11-14-7-9-16(10-8-14)25(23,24)21-15-5-3-4-6-15/h7-10,15,21H,3-6,11-13H2,1-2H3,(H,20,22) |
| InChIKey | KCWODCLXJSNLOJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|