C21H26N2O3S — CID 108736298
N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-methylbenzamide (PubChem CID 108736298) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 108736298 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCc2ccc(S(=O)(=O)NC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-16-5-4-6-18(15-16)21(24)22-14-13-17-9-11-20(12-10-17)27(25,26)23-19-7-2-3-8-19/h4-6,9-12,15,19,23H,2-3,7-8,13-14H2,1H3,(H,22,24) |
| InChIKey | DQHYXGKJSORSCF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |