C26H28N2O5S — CID 108736377
(E)-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide (PubChem CID 108736377) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is (E)-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108736377 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | (E)-N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-3-(6-methyl-4-oxochromen-3-yl)prop-2-enamide |
| SMILES | Cc1ccc2occ(/C=C/C(=O)NCCc3ccc(S(=O)(=O)NC4CCCC4)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C26H28N2O5S/c1-18-6-12-24-23(16-18)26(30)20(17-33-24)9-13-25(29)27-15-14-19-7-10-22(11-8-19)34(31,32)28-21-4-2-3-5-21/h6-13,16-17,21,28H,2-5,14-15H2,1H3,(H,27,29)/b13-9+ |
| InChIKey | IJSRGEBURVNSKC-UKTHLTGXSA-N |
| XLogP | 3.69 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|