C21H25N3O5S — CID 108736405
N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-2-methyl-3-nitrobenzamide (PubChem CID 108736405) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 108736405 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[2-[4-(cyclopentylsulfamoyl)phenyl]ethyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)NCCc2ccc(S(=O)(=O)NC3CCCC3)cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25N3O5S/c1-15-19(7-4-8-20(15)24(26)27)21(25)22-14-13-16-9-11-18(12-10-16)30(28,29)23-17-5-2-3-6-17/h4,7-12,17,23H,2-3,5-6,13-14H2,1H3,(H,22,25) |
| InChIKey | GOOKZDNKQZRZKD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|