C22H26N4O6S — CID 30127509
N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]-N'-(4-nitrophenyl)oxamide (PubChem CID 30127509) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]-N'-(4-nitrophenyl)oxamide.
| Compound Name | N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]-N'-(4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 30127509 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]-N'-(4-nitrophenyl)oxamide |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)NC2CCCCC2)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H26N4O6S/c27-21(22(28)24-17-8-10-19(11-9-17)26(29)30)23-15-14-16-6-12-20(13-7-16)33(31,32)25-18-4-2-1-3-5-18/h6-13,18,25H,1-5,14-15H2,(H,23,27)(H,24,28) |
| InChIKey | ZCMVBOGDPCYMMF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|