C22H26BrN3O4S — CID 30127102
N'-(4-bromophenyl)-N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]oxamide (PubChem CID 30127102) has the molecular formula C22H26BrN3O4S and a molecular weight of 508.44 g/mol. Its IUPAC name is N'-(4-bromophenyl)-N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]oxamide.
| Compound Name | N'-(4-bromophenyl)-N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 30127102 |
| Molecular Formula | C22H26BrN3O4S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N'-(4-bromophenyl)-N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]oxamide |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)NC2CCCCC2)cc1)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H26BrN3O4S/c23-17-8-10-18(11-9-17)25-22(28)21(27)24-15-14-16-6-12-20(13-7-16)31(29,30)26-19-4-2-1-3-5-19/h6-13,19,26H,1-5,14-15H2,(H,24,27)(H,25,28) |
| InChIKey | QALJJJOMOXJBQR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|