C21H31N3O4S — CID 30126755
N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]-2-oxo-2-piperidin-1-ylacetamide (PubChem CID 30126755) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]-2-oxo-2-piperidin-1-ylacetamide.
| Compound Name | N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]-2-oxo-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 30126755 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[2-[4-(cyclohexylsulfamoyl)phenyl]ethyl]-2-oxo-2-piperidin-1-ylacetamide |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)NC2CCCCC2)cc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H31N3O4S/c25-20(21(26)24-15-5-2-6-16-24)22-14-13-17-9-11-19(12-10-17)29(27,28)23-18-7-3-1-4-8-18/h9-12,18,23H,1-8,13-16H2,(H,22,25) |
| InChIKey | JROXGMOOBHOTQR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|