C18H18N4Na2O6S2 — CID 2831877
disodium;4-[2-[4-[(4-sulfonatophenyl)hydrazinylidene]cyclohexylidene]hydrazinyl]benzenesulfonate (PubChem CID 2831877) has the molecular formula C18H18N4Na2O6S2 and a molecular weight of 496.48 g/mol. Its IUPAC name is disodium;4-[2-[4-[(4-sulfonatophenyl)hydrazinylidene]cyclohexylidene]hydrazinyl]benzenesulfonate.
| Compound Name | disodium;4-[2-[4-[(4-sulfonatophenyl)hydrazinylidene]cyclohexylidene]hydrazinyl]benzenesulfonate |
|---|---|
| PubChem CID | 2831877 |
| Molecular Formula | C18H18N4Na2O6S2 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | disodium;4-[2-[4-[(4-sulfonatophenyl)hydrazinylidene]cyclohexylidene]hydrazinyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(NN=C2CCC(=NNc3ccc(S(=O)(=O)[O-])cc3)CC2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C18H20N4O6S2.2Na/c23-29(24,25)17-9-5-15(6-10-17)21-19-13-1-2-14(4-3-13)20-22-16-7-11-18(12-8-16)30(26,27)28;;/h5-12,21-22H,1-4H2,(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2/b19-13-,20-14+;; |
| InChIKey | BAROWRYRJGEFLH-BXUPKDGBSA-L |
| XLogP | -3.69 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|