C14H13N2O4S- — CID 3424835
4-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]benzenesulfonate (PubChem CID 3424835) has the molecular formula C14H13N2O4S- and a molecular weight of 305.34 g/mol. Its IUPAC name is 4-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]benzenesulfonate.
| Compound Name | 4-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]benzenesulfonate |
|---|---|
| PubChem CID | 3424835 |
| Molecular Formula | C14H13N2O4S- |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]benzenesulfonate |
| SMILES | CC(=NNc1ccc(S(=O)(=O)[O-])cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H14N2O4S/c1-10(11-2-6-13(17)7-3-11)15-16-12-4-8-14(9-5-12)21(18,19)20/h2-9,16-17H,1H3,(H,18,19,20)/p-1 |
| InChIKey | CNDZGGXMVNXVHT-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|