C8H7BrNNaO4S — CID 20688392
sodium 4-[(2-bromoacetyl)amino]benzenesulfonate (PubChem CID 20688392) has the molecular formula C8H7BrNNaO4S and a molecular weight of 316.11 g/mol. Its IUPAC name is sodium 4-[(2-bromoacetyl)amino]benzenesulfonate.
| Compound Name | sodium 4-[(2-bromoacetyl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 20688392 |
| Molecular Formula | C8H7BrNNaO4S |
| Molecular Weight | 316.11 g/mol |
| Exact Mass | 314.92 |
| IUPAC Name | sodium 4-[(2-bromoacetyl)amino]benzenesulfonate |
| SMILES | O=C(CBr)Nc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C8H8BrNO4S.Na/c9-5-8(11)10-6-1-3-7(4-2-6)15(12,13)14;/h1-4H,5H2,(H,10,11)(H,12,13,14);/q;+1/p-1 |
| InChIKey | YSEDNQRCHDLNAV-UHFFFAOYSA-M |
| XLogP | -2.07 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.11 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|