C10H13BrN2O3S — CID 63679707
2-bromo-N-[4-(ethylsulfonylamino)phenyl]acetamide (PubChem CID 63679707) has the molecular formula C10H13BrN2O3S and a molecular weight of 321.20 g/mol. Its IUPAC name is 2-bromo-N-[4-(ethylsulfonylamino)phenyl]acetamide.
| Compound Name | 2-bromo-N-[4-(ethylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 63679707 |
| Molecular Formula | C10H13BrN2O3S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 2-bromo-N-[4-(ethylsulfonylamino)phenyl]acetamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)CBr)cc1 |
| InChI | InChI=1S/C10H13BrN2O3S/c1-2-17(15,16)13-9-5-3-8(4-6-9)12-10(14)7-11/h3-6,13H,2,7H2,1H3,(H,12,14) |
| InChIKey | GYYRGUAGIFBMHK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|