C11H18N4O2S — CID 55068310
2-tert-butyl-1-(4-sulfamoylphenyl)guanidine (PubChem CID 55068310) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-tert-butyl-1-(4-sulfamoylphenyl)guanidine.
| Compound Name | 2-tert-butyl-1-(4-sulfamoylphenyl)guanidine |
|---|---|
| PubChem CID | 55068310 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-tert-butyl-1-(4-sulfamoylphenyl)guanidine |
| SMILES | CC(C)(C)/N=C(\N)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H18N4O2S/c1-11(2,3)15-10(12)14-8-4-6-9(7-5-8)18(13,16)17/h4-7H,1-3H3,(H3,12,14,15)(H2,13,16,17) |
| InChIKey | FRVAQTJPDFPUDK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|