C13H16N6O2S — CID 2873992
2-(4,6-dimethylpyrimidin-2-yl)-1-(4-sulfamoylphenyl)guanidine (PubChem CID 2873992) has the molecular formula C13H16N6O2S and a molecular weight of 320.38 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-sulfamoylphenyl)guanidine.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-sulfamoylphenyl)guanidine |
|---|---|
| PubChem CID | 2873992 |
| Molecular Formula | C13H16N6O2S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(4-sulfamoylphenyl)guanidine |
| SMILES | Cc1cc(C)nc(N=C(N)Nc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C13H16N6O2S/c1-8-7-9(2)17-13(16-8)19-12(14)18-10-3-5-11(6-4-10)22(15,20)21/h3-7H,1-2H3,(H2,15,20,21)(H3,14,16,17,18,19) |
| InChIKey | JMOQHXGEMPHAGA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|