C17H16BrN5 — CID 11545176
1-(4-bromonaphthalen-1-yl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine (PubChem CID 11545176) has the molecular formula C17H16BrN5 and a molecular weight of 370.25 g/mol. Its IUPAC name is 1-(4-bromonaphthalen-1-yl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine.
| Compound Name | 1-(4-bromonaphthalen-1-yl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 11545176 |
| Molecular Formula | C17H16BrN5 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-(4-bromonaphthalen-1-yl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
| SMILES | Cc1cc(C)nc(/N=C(\N)Nc2ccc(Br)c3ccccc23)n1 |
| InChI | InChI=1S/C17H16BrN5/c1-10-9-11(2)21-17(20-10)23-16(19)22-15-8-7-14(18)12-5-3-4-6-13(12)15/h3-9H,1-2H3,(H3,19,20,21,22,23) |
| InChIKey | XRIGJYPNKSJHTA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|