C16H18F3N5 — CID 78108509
2-(4-methyl-6-propylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine (PubChem CID 78108509) has the molecular formula C16H18F3N5 and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-(4-methyl-6-propylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-(4-methyl-6-propylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 78108509 |
| Molecular Formula | C16H18F3N5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-(4-methyl-6-propylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine |
| SMILES | CCCc1cc(C)nc(N=C(N)Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C16H18F3N5/c1-3-6-11-9-10(2)21-15(22-11)24-14(20)23-13-8-5-4-7-12(13)16(17,18)19/h4-5,7-9H,3,6H2,1-2H3,(H3,20,21,22,23,24) |
| InChIKey | WAPDPUYTPMNRDM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|