C13H12F3N5 — CID 78108578
2-(5-methylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine (PubChem CID 78108578) has the molecular formula C13H12F3N5 and a molecular weight of 295.27 g/mol. Its IUPAC name is 2-(5-methylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-(5-methylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 78108578 |
| Molecular Formula | C13H12F3N5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(5-methylpyrimidin-2-yl)-1-[2-(trifluoromethyl)phenyl]guanidine |
| SMILES | Cc1cnc(N=C(N)Nc2ccccc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C13H12F3N5/c1-8-6-18-12(19-7-8)21-11(17)20-10-5-3-2-4-9(10)13(14,15)16/h2-7H,1H3,(H3,17,18,19,20,21) |
| InChIKey | ZOBFMPILPJICCH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|