C29H24F3N5O — CID 162559190
N-[4-[6-[[amino-[2-(trifluoromethyl)anilino]methylidene]amino]-3-pyridinyl]phenyl]-1-phenylcyclopropane-1-carboxamide (PubChem CID 162559190) has the molecular formula C29H24F3N5O and a molecular weight of 515.54 g/mol. Its IUPAC name is N-[4-[6-[[amino-[2-(trifluoromethyl)anilino]methylidene]amino]-3-pyridinyl]phenyl]-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[4-[6-[[amino-[2-(trifluoromethyl)anilino]methylidene]amino]-3-pyridinyl]phenyl]-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 162559190 |
| Molecular Formula | C29H24F3N5O |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-[4-[6-[[amino-[2-(trifluoromethyl)anilino]methylidene]amino]-3-pyridinyl]phenyl]-1-phenylcyclopropane-1-carboxamide |
| SMILES | N/C(=N\c1ccc(-c2ccc(NC(=O)C3(c4ccccc4)CC3)cc2)cn1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H24F3N5O/c30-29(31,32)23-8-4-5-9-24(23)36-27(33)37-25-15-12-20(18-34-25)19-10-13-22(14-11-19)35-26(38)28(16-17-28)21-6-2-1-3-7-21/h1-15,18H,16-17H2,(H,35,38)(H3,33,34,36,37) |
| InChIKey | UZRYLJOWPBECHE-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|