C16H14F3N7OS2 — CID 135896220
2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-[2-(trifluoromethyl)phenyl]guanidine (PubChem CID 135896220) has the molecular formula C16H14F3N7OS2 and a molecular weight of 441.46 g/mol. Its IUPAC name is 2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-[2-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-[2-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 135896220 |
| Molecular Formula | C16H14F3N7OS2 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-[2-(trifluoromethyl)phenyl]guanidine |
| SMILES | Cc1nnc(SCc2cc(=O)[nH]c(N=C(N)Nc3ccccc3C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C16H14F3N7OS2/c1-8-25-26-15(29-8)28-7-9-6-12(27)23-14(21-9)24-13(20)22-11-5-3-2-4-10(11)16(17,18)19/h2-6H,7H2,1H3,(H4,20,21,22,23,24,27) |
| InChIKey | YTSLMSFEXCHPLS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|