C23H20F3N5O4 — CID 135414608
ethyl 2-[2-[(Z)-[benzamido-[2-(trifluoromethyl)anilino]methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate (PubChem CID 135414608) has the molecular formula C23H20F3N5O4 and a molecular weight of 487.44 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-[benzamido-[2-(trifluoromethyl)anilino]methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(Z)-[benzamido-[2-(trifluoromethyl)anilino]methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 135414608 |
| Molecular Formula | C23H20F3N5O4 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | ethyl 2-[2-[(Z)-[benzamido-[2-(trifluoromethyl)anilino]methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(=O)[nH]c(/N=C(\NC(=O)c2ccccc2)Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C23H20F3N5O4/c1-2-35-19(33)13-15-12-18(32)29-21(27-15)31-22(30-20(34)14-8-4-3-5-9-14)28-17-11-7-6-10-16(17)23(24,25)26/h3-12H,2,13H2,1H3,(H3,27,28,29,30,31,32,34) |
| InChIKey | IAYXLQBJQZLEDO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|