C17H21N5O5 — CID 135602302
ethyl 2-[2-[(E)-[amino-(3,5-dimethoxyanilino)methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate (PubChem CID 135602302) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl 2-[2-[(E)-[amino-(3,5-dimethoxyanilino)methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(E)-[amino-(3,5-dimethoxyanilino)methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 135602302 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 2-[2-[(E)-[amino-(3,5-dimethoxyanilino)methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(=O)[nH]c(/N=C(\N)Nc2cc(OC)cc(OC)c2)n1 |
| InChI | InChI=1S/C17H21N5O5/c1-4-27-15(24)8-11-7-14(23)21-17(20-11)22-16(18)19-10-5-12(25-2)9-13(6-10)26-3/h5-7,9H,4,8H2,1-3H3,(H4,18,19,20,21,22,23) |
| InChIKey | YXXMARMYCTYSBS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|