C19H19N5O2 — CID 135838337
2-[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]-1-(3-methylphenyl)guanidine (PubChem CID 135838337) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]-1-(3-methylphenyl)guanidine.
| Compound Name | 2-[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]-1-(3-methylphenyl)guanidine |
|---|---|
| PubChem CID | 135838337 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-6-oxo-1H-pyrimidin-2-yl]-1-(3-methylphenyl)guanidine |
| SMILES | COc1ccc(-c2cc(=O)[nH]c(/N=C(\N)Nc3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C19H19N5O2/c1-12-4-3-5-14(10-12)21-18(20)24-19-22-16(11-17(25)23-19)13-6-8-15(26-2)9-7-13/h3-11H,1-2H3,(H4,20,21,22,23,24,25) |
| InChIKey | IOKAPSKFBVYOMM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|