C17H15N5O — CID 135479085
2-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-1-phenylguanidine (PubChem CID 135479085) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-1-phenylguanidine.
| Compound Name | 2-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-1-phenylguanidine |
|---|---|
| PubChem CID | 135479085 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(6-oxo-4-phenyl-1H-pyrimidin-2-yl)-1-phenylguanidine |
| SMILES | NC(=Nc1nc(-c2ccccc2)cc(=O)[nH]1)Nc1ccccc1 |
| InChI | InChI=1S/C17H15N5O/c18-16(19-13-9-5-2-6-10-13)22-17-20-14(11-15(23)21-17)12-7-3-1-4-8-12/h1-11H,(H4,18,19,20,21,22,23) |
| InChIKey | QTRZDRHAVHIINW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|