C10H9N3O2 — CID 135421720
2-(hydroxyamino)-4-phenyl-1H-pyrimidin-6-one (PubChem CID 135421720) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-(hydroxyamino)-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 2-(hydroxyamino)-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135421720 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-(hydroxyamino)-4-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccccc2)nc(NO)[nH]1 |
| InChI | InChI=1S/C10H9N3O2/c14-9-6-8(11-10(12-9)13-15)7-4-2-1-3-5-7/h1-6,15H,(H2,11,12,13,14) |
| InChIKey | HTNOQOYSBUUBFN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|