C10H8N2O4S — CID 151172455
6-oxo-4-phenyl-1H-pyrimidine-2-sulfonic acid (PubChem CID 151172455) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 6-oxo-4-phenyl-1H-pyrimidine-2-sulfonic acid.
| Compound Name | 6-oxo-4-phenyl-1H-pyrimidine-2-sulfonic acid |
|---|---|
| PubChem CID | 151172455 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 6-oxo-4-phenyl-1H-pyrimidine-2-sulfonic acid |
| SMILES | O=c1cc(-c2ccccc2)nc(S(=O)(=O)O)[nH]1 |
| InChI | InChI=1S/C10H8N2O4S/c13-9-6-8(7-4-2-1-3-5-7)11-10(12-9)17(14,15)16/h1-6H,(H,11,12,13)(H,14,15,16) |
| InChIKey | NCOKNMBBYAGCII-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|