C15H15N7OS2 — CID 137314479
2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-phenylguanidine (PubChem CID 137314479) has the molecular formula C15H15N7OS2 and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-phenylguanidine.
| Compound Name | 2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-phenylguanidine |
|---|---|
| PubChem CID | 137314479 |
| Molecular Formula | C15H15N7OS2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]-1-phenylguanidine |
| SMILES | Cc1nnc(SCc2cc(=O)[nH]c(/N=C(/N)Nc3ccccc3)n2)s1 |
| InChI | InChI=1S/C15H15N7OS2/c1-9-21-22-15(25-9)24-8-11-7-12(23)19-14(18-11)20-13(16)17-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H4,16,17,18,19,20,23) |
| InChIKey | CEUDOIQOVHDHFX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|