C17H20N7OS2+ — CID 135749002
[amino-(2,4-dimethylanilino)methylidene]-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]azanium (PubChem CID 135749002) has the molecular formula C17H20N7OS2+ and a molecular weight of 402.53 g/mol. Its IUPAC name is [amino-(2,4-dimethylanilino)methylidene]-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]azanium.
| Compound Name | [amino-(2,4-dimethylanilino)methylidene]-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 135749002 |
| Molecular Formula | C17H20N7OS2+ |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [amino-(2,4-dimethylanilino)methylidene]-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-oxo-1H-pyrimidin-2-yl]azanium |
| SMILES | Cc1ccc(NC(N)=[NH+]c2nc(CSc3nnc(C)s3)cc(=O)[nH]2)c(C)c1 |
| InChI | InChI=1S/C17H19N7OS2/c1-9-4-5-13(10(2)6-9)20-15(18)22-16-19-12(7-14(25)21-16)8-26-17-24-23-11(3)27-17/h4-7H,8H2,1-3H3,(H4,18,19,20,21,22,25)/p+1 |
| InChIKey | KCSCWUBVNMKIKN-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|