C18H20N7O2S+ — CID 135690247
[amino-(4-ethoxyanilino)methylidene]-[6-oxo-4-(pyrimidin-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]azanium (PubChem CID 135690247) has the molecular formula C18H20N7O2S+ and a molecular weight of 398.47 g/mol. Its IUPAC name is [amino-(4-ethoxyanilino)methylidene]-[6-oxo-4-(pyrimidin-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]azanium.
| Compound Name | [amino-(4-ethoxyanilino)methylidene]-[6-oxo-4-(pyrimidin-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 135690247 |
| Molecular Formula | C18H20N7O2S+ |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [amino-(4-ethoxyanilino)methylidene]-[6-oxo-4-(pyrimidin-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]azanium |
| SMILES | CCOc1ccc(NC(N)=[NH+]c2nc(CSc3ncccn3)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H19N7O2S/c1-2-27-14-6-4-12(5-7-14)22-16(19)25-17-23-13(10-15(26)24-17)11-28-18-20-8-3-9-21-18/h3-10H,2,11H2,1H3,(H4,19,22,23,24,25,26)/p+1 |
| InChIKey | GXYMJNVGXAKOGX-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|