C12H13ClN5O+ — CID 135708314
[amino-(4-chloroanilino)methylidene]-(4-methyl-6-oxo-1H-pyrimidin-2-yl)azanium (PubChem CID 135708314) has the molecular formula C12H13ClN5O+ and a molecular weight of 278.72 g/mol. Its IUPAC name is [amino-(4-chloroanilino)methylidene]-(4-methyl-6-oxo-1H-pyrimidin-2-yl)azanium.
| Compound Name | [amino-(4-chloroanilino)methylidene]-(4-methyl-6-oxo-1H-pyrimidin-2-yl)azanium |
|---|---|
| PubChem CID | 135708314 |
| Molecular Formula | C12H13ClN5O+ |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | [amino-(4-chloroanilino)methylidene]-(4-methyl-6-oxo-1H-pyrimidin-2-yl)azanium |
| SMILES | Cc1cc(=O)[nH]c([NH+]=C(N)Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H12ClN5O/c1-7-6-10(19)17-12(15-7)18-11(14)16-9-4-2-8(13)3-5-9/h2-6H,1H3,(H4,14,15,16,17,18,19)/p+1 |
| InChIKey | NBQWRVCOQQZQCH-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|