About [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium
[amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium (PubChem CID 135583543) has the molecular formula C13H14F2N5O2+
and a molecular weight of 310.28 g/mol. Its IUPAC name is [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium.
Molecular Properties
| Compound Name | [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium |
| PubChem CID | 135583543 |
| Molecular Formula | C13H14F2N5O2+ |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium |
| SMILES | COCc1cc(=O)[nH]c([NH+]=C(N)Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C13H13F2N5O2/c1-22-6-7-5-10(21)18-13(17-7)20-12(16)19-11-8(14)3-2-4-9(11)15/h2-5H,6H2,1H3,(H4,16,17,18,19,20,21)/p+1 |
| InChIKey | FMLZAWVULLUWJZ-UHFFFAOYSA-O |
| XLogP | -0.67 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium?
The IUPAC name of [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium (CID 135583543) is [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium.
What is the SMILES notation for [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium?
The canonical SMILES for [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium is COCc1cc(=O)[nH]c([NH+]=C(N)Nc2c(F)cccc2F)n1.
What is the InChIKey of [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium?
The InChIKey is FMLZAWVULLUWJZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H13F2N5O2/c1-22-6-7-5-10(21)18-13(17-7)20-12(16)19-11-8(14)3-2-4-9(11)15/h2-5H,6H2,1H3,(H4,16,17,18,19,20,21)/p+1.
What are the key properties of [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium?
[amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium has a molecular weight of 310.28 g/mol, XLogP of -0.67, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-(2,6-difluoroanilino)methylidene]-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]azanium is sourced from PubChem (CID 135583543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).