C12H10F3N3O2 — CID 136741563
4-(methoxymethyl)-2-(2,4,5-trifluoroanilino)-1H-pyrimidin-6-one (PubChem CID 136741563) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-(2,4,5-trifluoroanilino)-1H-pyrimidin-6-one.
| Compound Name | 4-(methoxymethyl)-2-(2,4,5-trifluoroanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136741563 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-(methoxymethyl)-2-(2,4,5-trifluoroanilino)-1H-pyrimidin-6-one |
| SMILES | COCc1cc(=O)[nH]c(Nc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C12H10F3N3O2/c1-20-5-6-2-11(19)18-12(16-6)17-10-4-8(14)7(13)3-9(10)15/h2-4H,5H2,1H3,(H2,16,17,18,19) |
| InChIKey | FRKXXQVNMBNNNY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|