C17H21N3O4 — CID 136779179
2-methylpropyl 4-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]amino]benzoate (PubChem CID 136779179) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-methylpropyl 4-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 136779179 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-methylpropyl 4-[[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]amino]benzoate |
| SMILES | COCc1cc(=O)[nH]c(Nc2ccc(C(=O)OCC(C)C)cc2)n1 |
| InChI | InChI=1S/C17H21N3O4/c1-11(2)9-24-16(22)12-4-6-13(7-5-12)18-17-19-14(10-23-3)8-15(21)20-17/h4-8,11H,9-10H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | DEGQYCDAKDXISY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |