C18H23N3O3S — CID 136778729
propyl 4-[[6-oxo-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]amino]benzoate (PubChem CID 136778729) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is propyl 4-[[6-oxo-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]amino]benzoate.
| Compound Name | propyl 4-[[6-oxo-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 136778729 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | propyl 4-[[6-oxo-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(Nc2nc(CSC(C)C)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-4-9-24-17(23)13-5-7-14(8-6-13)19-18-20-15(10-16(22)21-18)11-25-12(2)3/h5-8,10,12H,4,9,11H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | LLDFCFTVRFCFJC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |