C19H25N3O3 — CID 136779121
butyl 3-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)amino]benzoate (PubChem CID 136779121) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is butyl 3-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)amino]benzoate.
| Compound Name | butyl 3-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 136779121 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | butyl 3-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)amino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(Nc2nc(CCCC)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-3-5-9-16-13-17(23)22-19(21-16)20-15-10-7-8-14(12-15)18(24)25-11-6-4-2/h7-8,10,12-13H,3-6,9,11H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | ARLIMMUSFIIFCV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|