C19H25N3O3S — CID 136779106
butyl 4-[[6-oxo-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]amino]benzoate (PubChem CID 136779106) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is butyl 4-[[6-oxo-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]amino]benzoate.
| Compound Name | butyl 4-[[6-oxo-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 136779106 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | butyl 4-[[6-oxo-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-2-yl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(Nc2nc(CSC(C)C)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-4-5-10-25-18(24)14-6-8-15(9-7-14)20-19-21-16(11-17(23)22-19)12-26-13(2)3/h6-9,11,13H,4-5,10,12H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | KEFVWWZHCMMPMU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|