C19H22N4O2 — CID 110431097
butyl 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoate (PubChem CID 110431097) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is butyl 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoate.
| Compound Name | butyl 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 110431097 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | butyl 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(Nc2nc(C)nc3[nH]c(C)cc23)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-4-5-10-25-19(24)14-6-8-15(9-7-14)23-18-16-11-12(2)20-17(16)21-13(3)22-18/h6-9,11H,4-5,10H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | AVTVNKHKYJHPAQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|