C18H20N4O2 — CID 110430937
propyl 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoate (PubChem CID 110430937) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is propyl 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoate.
| Compound Name | propyl 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 110430937 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | propyl 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(Nc2nc(C)nc3[nH]c(C)cc23)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-4-9-24-18(23)13-5-7-14(8-6-13)22-17-15-10-11(2)19-16(15)20-12(3)21-17/h5-8,10H,4,9H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | JYXDGTQZBHPLMW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |