C19H23N5 — CID 110430903
2,6-dimethyl-N-(4-piperidin-1-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 110430903) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2,6-dimethyl-N-(4-piperidin-1-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2,6-dimethyl-N-(4-piperidin-1-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110430903 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 2,6-dimethyl-N-(4-piperidin-1-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccc(N3CCCCC3)cc2)c2cc(C)[nH]c2n1 |
| InChI | InChI=1S/C19H23N5/c1-13-12-17-18(20-13)21-14(2)22-19(17)23-15-6-8-16(9-7-15)24-10-4-3-5-11-24/h6-9,12H,3-5,10-11H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | HSUHRSOBOYMUIA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|