C14H20N4 — CID 110430224
4-(azepan-1-yl)-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 110430224) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-(azepan-1-yl)-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(azepan-1-yl)-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 110430224 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-(azepan-1-yl)-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1nc(N2CCCCCC2)c2cc(C)[nH]c2n1 |
| InChI | InChI=1S/C14H20N4/c1-10-9-12-13(15-10)16-11(2)17-14(12)18-7-5-3-4-6-8-18/h9H,3-8H2,1-2H3,(H,15,16,17) |
| InChIKey | JPMMQWLJQIBDFT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |