C15H14N4O2 — CID 110430519
4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoic acid (PubChem CID 110430519) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 110430519 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-[(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]benzoic acid |
| SMILES | Cc1nc(Nc2ccc(C(=O)O)cc2)c2cc(C)[nH]c2n1 |
| InChI | InChI=1S/C15H14N4O2/c1-8-7-12-13(16-8)17-9(2)18-14(12)19-11-5-3-10(4-6-11)15(20)21/h3-7H,1-2H3,(H,20,21)(H2,16,17,18,19) |
| InChIKey | TYBBYETUAYHMQM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |