C18H23N3O3 — CID 136778726
propyl 4-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)amino]benzoate (PubChem CID 136778726) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is propyl 4-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)amino]benzoate.
| Compound Name | propyl 4-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 136778726 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | propyl 4-[(4-butyl-6-oxo-1H-pyrimidin-2-yl)amino]benzoate |
| SMILES | CCCCc1cc(=O)[nH]c(Nc2ccc(C(=O)OCCC)cc2)n1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-5-6-15-12-16(22)21-18(20-15)19-14-9-7-13(8-10-14)17(23)24-11-4-2/h7-10,12H,3-6,11H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | XQVQOJVZKILFAP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |