C16H21N3O — CID 136779086
4-butyl-2-(2,4-dimethylanilino)-1H-pyrimidin-6-one (PubChem CID 136779086) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-butyl-2-(2,4-dimethylanilino)-1H-pyrimidin-6-one.
| Compound Name | 4-butyl-2-(2,4-dimethylanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136779086 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-butyl-2-(2,4-dimethylanilino)-1H-pyrimidin-6-one |
| SMILES | CCCCc1cc(=O)[nH]c(Nc2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C16H21N3O/c1-4-5-6-13-10-15(20)19-16(17-13)18-14-8-7-11(2)9-12(14)3/h7-10H,4-6H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | MMLFMRYPDUOSBF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |