C14H15F2N3O — CID 136779304
4-butyl-2-(2,5-difluoroanilino)-1H-pyrimidin-6-one (PubChem CID 136779304) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is 4-butyl-2-(2,5-difluoroanilino)-1H-pyrimidin-6-one.
| Compound Name | 4-butyl-2-(2,5-difluoroanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136779304 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-butyl-2-(2,5-difluoroanilino)-1H-pyrimidin-6-one |
| SMILES | CCCCc1cc(=O)[nH]c(Nc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C14H15F2N3O/c1-2-3-4-10-8-13(20)19-14(17-10)18-12-7-9(15)5-6-11(12)16/h5-8H,2-4H2,1H3,(H2,17,18,19,20) |
| InChIKey | DKGURKJLYFUSAT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |