C11H9F2N3O — CID 136779284
2-(2,4-difluoroanilino)-4-methyl-1H-pyrimidin-6-one (PubChem CID 136779284) has the molecular formula C11H9F2N3O and a molecular weight of 237.21 g/mol. Its IUPAC name is 2-(2,4-difluoroanilino)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(2,4-difluoroanilino)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136779284 |
| Molecular Formula | C11H9F2N3O |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(2,4-difluoroanilino)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C11H9F2N3O/c1-6-4-10(17)16-11(14-6)15-9-3-2-7(12)5-8(9)13/h2-5H,1H3,(H2,14,15,16,17) |
| InChIKey | DFVNOHXMWYNDJJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |