C14H17N3O2 — CID 136780144
4-butyl-2-(4-hydroxyanilino)-1H-pyrimidin-6-one (PubChem CID 136780144) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-butyl-2-(4-hydroxyanilino)-1H-pyrimidin-6-one.
| Compound Name | 4-butyl-2-(4-hydroxyanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136780144 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-butyl-2-(4-hydroxyanilino)-1H-pyrimidin-6-one |
| SMILES | CCCCc1cc(=O)[nH]c(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C14H17N3O2/c1-2-3-4-11-9-13(19)17-14(16-11)15-10-5-7-12(18)8-6-10/h5-9,18H,2-4H2,1H3,(H2,15,16,17,19) |
| InChIKey | ZNFBZBPRCVMLHG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|