C20H22N4OS — CID 136778990
2-(4-anilinoanilino)-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 136778990) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-(4-anilinoanilino)-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(4-anilinoanilino)-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136778990 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-(4-anilinoanilino)-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)SCc1cc(=O)[nH]c(Nc2ccc(Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C20H22N4OS/c1-14(2)26-13-18-12-19(25)24-20(23-18)22-17-10-8-16(9-11-17)21-15-6-4-3-5-7-15/h3-12,14,21H,13H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | KGBWUOBIZKPUHG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |