C18H25N3OS2 — CID 136683757
4-(propan-2-ylsulfanylmethyl)-2-[4-(propylsulfanylmethyl)anilino]-1H-pyrimidin-6-one (PubChem CID 136683757) has the molecular formula C18H25N3OS2 and a molecular weight of 363.55 g/mol. Its IUPAC name is 4-(propan-2-ylsulfanylmethyl)-2-[4-(propylsulfanylmethyl)anilino]-1H-pyrimidin-6-one.
| Compound Name | 4-(propan-2-ylsulfanylmethyl)-2-[4-(propylsulfanylmethyl)anilino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136683757 |
| Molecular Formula | C18H25N3OS2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-(propan-2-ylsulfanylmethyl)-2-[4-(propylsulfanylmethyl)anilino]-1H-pyrimidin-6-one |
| SMILES | CCCSCc1ccc(Nc2nc(CSC(C)C)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H25N3OS2/c1-4-9-23-11-14-5-7-15(8-6-14)19-18-20-16(10-17(22)21-18)12-24-13(2)3/h5-8,10,13H,4,9,11-12H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | JOYVFUAUFPFOMR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|